C32H50N5O6+ — CID 58848009
4-[butyl-[2-[(2S,3R,4S)-3-carboxy-4-(7-methoxy-1,3-benzodioxol-5-yl)-2-[2-(1-methylimidazol-2-yl)ethyl]pyrrolidin-1-yl]acetyl]amino]butyl-trimethylazanium (PubChem CID 58848009) has the molecular formula C32H50N5O6+ and a molecular weight of 600.78 g/mol. Its IUPAC name is 4-[butyl-[2-[(2S,3R,4S)-3-carboxy-4-(7-methoxy-1,3-benzodioxol-5-yl)-2-[2-(1-methylimidazol-2-yl)ethyl]pyrrolidin-1-yl]acetyl]amino]butyl-trimethylazanium.
| Compound Name | 4-[butyl-[2-[(2S,3R,4S)-3-carboxy-4-(7-methoxy-1,3-benzodioxol-5-yl)-2-[2-(1-methylimidazol-2-yl)ethyl]pyrrolidin-1-yl]acetyl]amino]butyl-trimethylazanium |
|---|---|
| PubChem CID | 58848009 |
| Molecular Formula | C32H50N5O6+ |
| Molecular Weight | 600.78 g/mol |
| Exact Mass | 600.38 |
| IUPAC Name | 4-[butyl-[2-[(2S,3R,4S)-3-carboxy-4-(7-methoxy-1,3-benzodioxol-5-yl)-2-[2-(1-methylimidazol-2-yl)ethyl]pyrrolidin-1-yl]acetyl]amino]butyl-trimethylazanium |
| SMILES | CCCCN(CCCC[N+](C)(C)C)C(=O)CN1C[C@H](c2cc(OC)c3c(c2)OCO3)[C@@H](C(=O)O)[C@@H]1CCc1nccn1C |
| InChI | InChI=1S/C32H49N5O6/c1-7-8-14-35(15-9-10-17-37(3,4)5)29(38)21-36-20-24(23-18-26(41-6)31-27(19-23)42-22-43-31)30(32(39)40)25(36)11-12-28-33-13-16-34(28)2/h13,16,18-19,24-25,30H,7-12,14-15,17,20-22H2,1-6H3/p+1/t24-,25+,30-/m1/s1 |
| InChIKey | WWTNTHLDODAUCN-UNHDOIQYSA-O |
| XLogP | 3.37 |
| TPSA | 106.36 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 43 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 600.78 |
| LogP ≤ 5 | 3.37 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|