C33H53N4O7+ — CID 20870540
4-[butyl-[2-[3-carboxy-4-(7-methoxy-1,3-benzodioxol-5-yl)-2-[2-(2-oxopiperidin-1-yl)ethyl]pyrrolidin-1-yl]acetyl]amino]butyl-trimethylazanium (PubChem CID 20870540) has the molecular formula C33H53N4O7+ and a molecular weight of 617.81 g/mol. Its IUPAC name is 4-[butyl-[2-[3-carboxy-4-(7-methoxy-1,3-benzodioxol-5-yl)-2-[2-(2-oxopiperidin-1-yl)ethyl]pyrrolidin-1-yl]acetyl]amino]butyl-trimethylazanium.
| Compound Name | 4-[butyl-[2-[3-carboxy-4-(7-methoxy-1,3-benzodioxol-5-yl)-2-[2-(2-oxopiperidin-1-yl)ethyl]pyrrolidin-1-yl]acetyl]amino]butyl-trimethylazanium |
|---|---|
| PubChem CID | 20870540 |
| Molecular Formula | C33H53N4O7+ |
| Molecular Weight | 617.81 g/mol |
| Exact Mass | 617.39 |
| IUPAC Name | 4-[butyl-[2-[3-carboxy-4-(7-methoxy-1,3-benzodioxol-5-yl)-2-[2-(2-oxopiperidin-1-yl)ethyl]pyrrolidin-1-yl]acetyl]amino]butyl-trimethylazanium |
| SMILES | CCCCN(CCCC[N+](C)(C)C)C(=O)CN1CC(c2cc(OC)c3c(c2)OCO3)C(C(=O)O)C1CCN1CCCCC1=O |
| InChI | InChI=1S/C33H52N4O7/c1-6-7-14-34(16-10-11-18-37(2,3)4)30(39)22-36-21-25(24-19-27(42-5)32-28(20-24)43-23-44-32)31(33(40)41)26(36)13-17-35-15-9-8-12-29(35)38/h19-20,25-26,31H,6-18,21-23H2,1-5H3/p+1 |
| InChIKey | HMKIAXBCNJZWIT-UHFFFAOYSA-O |
| XLogP | 3.41 |
| TPSA | 108.85 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 44 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 617.81 |
| LogP ≤ 5 | 3.41 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|