C34H50N3O8+ — CID 54570906
4-[butyl-[2-[(2R,4S)-3-carboxy-4-(7-methoxy-1,3-benzodioxol-5-yl)-2-[(2-methoxyphenoxy)methyl]pyrrolidin-1-yl]acetyl]amino]butyl-trimethylazanium (PubChem CID 54570906) has the molecular formula C34H50N3O8+ and a molecular weight of 628.79 g/mol. Its IUPAC name is 4-[butyl-[2-[(2R,4S)-3-carboxy-4-(7-methoxy-1,3-benzodioxol-5-yl)-2-[(2-methoxyphenoxy)methyl]pyrrolidin-1-yl]acetyl]amino]butyl-trimethylazanium.
| Compound Name | 4-[butyl-[2-[(2R,4S)-3-carboxy-4-(7-methoxy-1,3-benzodioxol-5-yl)-2-[(2-methoxyphenoxy)methyl]pyrrolidin-1-yl]acetyl]amino]butyl-trimethylazanium |
|---|---|
| PubChem CID | 54570906 |
| Molecular Formula | C34H50N3O8+ |
| Molecular Weight | 628.79 g/mol |
| Exact Mass | 628.36 |
| IUPAC Name | 4-[butyl-[2-[(2R,4S)-3-carboxy-4-(7-methoxy-1,3-benzodioxol-5-yl)-2-[(2-methoxyphenoxy)methyl]pyrrolidin-1-yl]acetyl]amino]butyl-trimethylazanium |
| SMILES | CCCCN(CCCC[N+](C)(C)C)C(=O)CN1C[C@H](c2cc(OC)c3c(c2)OCO3)C(C(=O)O)[C@@H]1COc1ccccc1OC |
| InChI | InChI=1S/C34H49N3O8/c1-7-8-15-35(16-11-12-17-37(2,3)4)31(38)21-36-20-25(24-18-29(42-6)33-30(19-24)44-23-45-33)32(34(39)40)26(36)22-43-28-14-10-9-13-27(28)41-5/h9-10,13-14,18-19,25-26,32H,7-8,11-12,15-17,20-23H2,1-6H3/p+1/t25-,26+,32?/m1/s1 |
| InChIKey | ZXENZZDVQWKGGD-RCVNQITKSA-O |
| XLogP | 4.10 |
| TPSA | 107.00 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 45 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 628.79 |
| LogP ≤ 5 | 4.10 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|