C34H56N3O6+ — CID 58847635
4-[butyl-[2-[(2S,3R,4S)-3-carboxy-4-(7-methoxy-1,3-benzodioxol-5-yl)-2-(2,2,4-trimethylpent-3-enyl)pyrrolidin-1-yl]acetyl]amino]butyl-trimethylazanium (PubChem CID 58847635) has the molecular formula C34H56N3O6+ and a molecular weight of 602.84 g/mol. Its IUPAC name is 4-[butyl-[2-[(2S,3R,4S)-3-carboxy-4-(7-methoxy-1,3-benzodioxol-5-yl)-2-(2,2,4-trimethylpent-3-enyl)pyrrolidin-1-yl]acetyl]amino]butyl-trimethylazanium.
| Compound Name | 4-[butyl-[2-[(2S,3R,4S)-3-carboxy-4-(7-methoxy-1,3-benzodioxol-5-yl)-2-(2,2,4-trimethylpent-3-enyl)pyrrolidin-1-yl]acetyl]amino]butyl-trimethylazanium |
|---|---|
| PubChem CID | 58847635 |
| Molecular Formula | C34H56N3O6+ |
| Molecular Weight | 602.84 g/mol |
| Exact Mass | 602.42 |
| IUPAC Name | 4-[butyl-[2-[(2S,3R,4S)-3-carboxy-4-(7-methoxy-1,3-benzodioxol-5-yl)-2-(2,2,4-trimethylpent-3-enyl)pyrrolidin-1-yl]acetyl]amino]butyl-trimethylazanium |
| SMILES | CCCCN(CCCC[N+](C)(C)C)C(=O)CN1C[C@H](c2cc(OC)c3c(c2)OCO3)[C@@H](C(=O)O)[C@@H]1CC(C)(C)C=C(C)C |
| InChI | InChI=1S/C34H55N3O6/c1-10-11-14-35(15-12-13-16-37(6,7)8)30(38)22-36-21-26(25-17-28(41-9)32-29(18-25)42-23-43-32)31(33(39)40)27(36)20-34(4,5)19-24(2)3/h17-19,26-27,31H,10-16,20-23H2,1-9H3/p+1/t26-,27+,31-/m1/s1 |
| InChIKey | DPNYDWIRDWLYKU-FMVCKAMOSA-O |
| XLogP | 5.39 |
| TPSA | 88.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 602.84 |
| LogP ≤ 5 | 5.39 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|