C29H45N3O6 — CID 58848122
(2S,3R,4S)-1-[2-[3-aminopropyl(butyl)amino]-2-oxoethyl]-2-[(E)-2,2-dimethylpent-3-enyl]-4-(7-methoxy-1,3-benzodioxol-5-yl)pyrrolidine-3-carboxylic acid (PubChem CID 58848122) has the molecular formula C29H45N3O6 and a molecular weight of 531.69 g/mol. Its IUPAC name is (2S,3R,4S)-1-[2-[3-aminopropyl(butyl)amino]-2-oxoethyl]-2-[(E)-2,2-dimethylpent-3-enyl]-4-(7-methoxy-1,3-benzodioxol-5-yl)pyrrolidine-3-carboxylic acid.
| Compound Name | (2S,3R,4S)-1-[2-[3-aminopropyl(butyl)amino]-2-oxoethyl]-2-[(E)-2,2-dimethylpent-3-enyl]-4-(7-methoxy-1,3-benzodioxol-5-yl)pyrrolidine-3-carboxylic acid |
|---|---|
| PubChem CID | 58848122 |
| Molecular Formula | C29H45N3O6 |
| Molecular Weight | 531.69 g/mol |
| Exact Mass | 531.33 |
| IUPAC Name | (2S,3R,4S)-1-[2-[3-aminopropyl(butyl)amino]-2-oxoethyl]-2-[(E)-2,2-dimethylpent-3-enyl]-4-(7-methoxy-1,3-benzodioxol-5-yl)pyrrolidine-3-carboxylic acid |
| SMILES | C/C=C/C(C)(C)C[C@H]1[C@H](C(=O)O)[C@@H](c2cc(OC)c3c(c2)OCO3)CN1CC(=O)N(CCCC)CCCN |
| InChI | InChI=1S/C29H45N3O6/c1-6-8-12-31(13-9-11-30)25(33)18-32-17-21(20-14-23(36-5)27-24(15-20)37-19-38-27)26(28(34)35)22(32)16-29(3,4)10-7-2/h7,10,14-15,21-22,26H,6,8-9,11-13,16-19,30H2,1-5H3,(H,34,35)/b10-7+/t21-,22+,26-/m1/s1 |
| InChIKey | RGWKPOVKDKPWHA-VQOAHNSOSA-N |
| XLogP | 3.86 |
| TPSA | 114.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 531.69 |
| LogP ≤ 5 | 3.86 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|