C36H52N3O6+ — CID 58849115
[3-[butyl-[2-[(2S,3R,4S)-3-carboxy-2-[(E)-2,2-dimethylpent-3-enyl]-4-(7-methoxy-1,3-benzodioxol-5-yl)pyrrolidin-1-yl]acetyl]amino]phenyl]methyl-trimethylazanium (PubChem CID 58849115) has the molecular formula C36H52N3O6+ and a molecular weight of 622.83 g/mol. Its IUPAC name is [3-[butyl-[2-[(2S,3R,4S)-3-carboxy-2-[(E)-2,2-dimethylpent-3-enyl]-4-(7-methoxy-1,3-benzodioxol-5-yl)pyrrolidin-1-yl]acetyl]amino]phenyl]methyl-trimethylazanium.
| Compound Name | [3-[butyl-[2-[(2S,3R,4S)-3-carboxy-2-[(E)-2,2-dimethylpent-3-enyl]-4-(7-methoxy-1,3-benzodioxol-5-yl)pyrrolidin-1-yl]acetyl]amino]phenyl]methyl-trimethylazanium |
|---|---|
| PubChem CID | 58849115 |
| Molecular Formula | C36H52N3O6+ |
| Molecular Weight | 622.83 g/mol |
| Exact Mass | 622.39 |
| IUPAC Name | [3-[butyl-[2-[(2S,3R,4S)-3-carboxy-2-[(E)-2,2-dimethylpent-3-enyl]-4-(7-methoxy-1,3-benzodioxol-5-yl)pyrrolidin-1-yl]acetyl]amino]phenyl]methyl-trimethylazanium |
| SMILES | C/C=C/C(C)(C)C[C@H]1[C@H](C(=O)O)[C@@H](c2cc(OC)c3c(c2)OCO3)CN1CC(=O)N(CCCC)c1cccc(C[N+](C)(C)C)c1 |
| InChI | InChI=1S/C36H51N3O6/c1-9-11-16-38(27-14-12-13-25(17-27)23-39(5,6)7)32(40)22-37-21-28(26-18-30(43-8)34-31(19-26)44-24-45-34)33(35(41)42)29(37)20-36(3,4)15-10-2/h10,12-15,17-19,28-29,33H,9,11,16,20-24H2,1-8H3/p+1/b15-10+/t28-,29+,33-/m1/s1 |
| InChIKey | TZAYZBQXOQEWNM-QCHFHLBJSA-O |
| XLogP | 5.92 |
| TPSA | 88.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 622.83 |
| LogP ≤ 5 | 5.92 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|