C36H52N3O5+ — CID 20869884
[3-[[2-[4-(1,3-benzodioxol-5-yl)-3-carboxy-2-(2,2,4-trimethylpent-3-enyl)pyrrolidin-1-yl]acetyl]-butylamino]phenyl]methyl-trimethylazanium (PubChem CID 20869884) has the molecular formula C36H52N3O5+ and a molecular weight of 606.83 g/mol. Its IUPAC name is [3-[[2-[4-(1,3-benzodioxol-5-yl)-3-carboxy-2-(2,2,4-trimethylpent-3-enyl)pyrrolidin-1-yl]acetyl]-butylamino]phenyl]methyl-trimethylazanium.
| Compound Name | [3-[[2-[4-(1,3-benzodioxol-5-yl)-3-carboxy-2-(2,2,4-trimethylpent-3-enyl)pyrrolidin-1-yl]acetyl]-butylamino]phenyl]methyl-trimethylazanium |
|---|---|
| PubChem CID | 20869884 |
| Molecular Formula | C36H52N3O5+ |
| Molecular Weight | 606.83 g/mol |
| Exact Mass | 606.39 |
| IUPAC Name | [3-[[2-[4-(1,3-benzodioxol-5-yl)-3-carboxy-2-(2,2,4-trimethylpent-3-enyl)pyrrolidin-1-yl]acetyl]-butylamino]phenyl]methyl-trimethylazanium |
| SMILES | CCCCN(C(=O)CN1CC(c2ccc3c(c2)OCO3)C(C(=O)O)C1CC(C)(C)C=C(C)C)c1cccc(C[N+](C)(C)C)c1 |
| InChI | InChI=1S/C36H51N3O5/c1-9-10-16-38(28-13-11-12-26(17-28)23-39(6,7)8)33(40)22-37-21-29(27-14-15-31-32(18-27)44-24-43-31)34(35(41)42)30(37)20-36(4,5)19-25(2)3/h11-15,17-19,29-30,34H,9-10,16,20-24H2,1-8H3/p+1 |
| InChIKey | YJPSHAXNDLVLFU-UHFFFAOYSA-O |
| XLogP | 6.31 |
| TPSA | 79.31 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 606.83 |
| LogP ≤ 5 | 6.31 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|