C29H44N2O6 — CID 58849148
(2S,3R,4S)-4-(1,3-benzodioxol-5-yl)-1-[2-[butyl(propoxy)amino]-2-oxoethyl]-2-(2,2,4-trimethylpent-3-enyl)pyrrolidine-3-carboxylic acid (PubChem CID 58849148) has the molecular formula C29H44N2O6 and a molecular weight of 516.68 g/mol. Its IUPAC name is (2S,3R,4S)-4-(1,3-benzodioxol-5-yl)-1-[2-[butyl(propoxy)amino]-2-oxoethyl]-2-(2,2,4-trimethylpent-3-enyl)pyrrolidine-3-carboxylic acid.
| Compound Name | (2S,3R,4S)-4-(1,3-benzodioxol-5-yl)-1-[2-[butyl(propoxy)amino]-2-oxoethyl]-2-(2,2,4-trimethylpent-3-enyl)pyrrolidine-3-carboxylic acid |
|---|---|
| PubChem CID | 58849148 |
| Molecular Formula | C29H44N2O6 |
| Molecular Weight | 516.68 g/mol |
| Exact Mass | 516.32 |
| IUPAC Name | (2S,3R,4S)-4-(1,3-benzodioxol-5-yl)-1-[2-[butyl(propoxy)amino]-2-oxoethyl]-2-(2,2,4-trimethylpent-3-enyl)pyrrolidine-3-carboxylic acid |
| SMILES | CCCCN(OCCC)C(=O)CN1C[C@H](c2ccc3c(c2)OCO3)[C@@H](C(=O)O)[C@@H]1CC(C)(C)C=C(C)C |
| InChI | InChI=1S/C29H44N2O6/c1-7-9-12-31(37-13-8-2)26(32)18-30-17-22(21-10-11-24-25(14-21)36-19-35-24)27(28(33)34)23(30)16-29(5,6)15-20(3)4/h10-11,14-15,22-23,27H,7-9,12-13,16-19H2,1-6H3,(H,33,34)/t22-,23+,27-/m1/s1 |
| InChIKey | FQLDFNSLHPIVAB-QSEAXJEQSA-N |
| XLogP | 5.24 |
| TPSA | 88.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 516.68 |
| LogP ≤ 5 | 5.24 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|