C31H50N3O5+ — CID 54461376
3-[[2-[(2S,4S)-4-(1,3-benzodioxol-5-yl)-3-carboxy-2-(2,2-dimethylpent-3-enyl)pyrrolidin-1-yl]acetyl]-butylamino]propyl-trimethylazanium (PubChem CID 54461376) has the molecular formula C31H50N3O5+ and a molecular weight of 544.76 g/mol. Its IUPAC name is 3-[[2-[(2S,4S)-4-(1,3-benzodioxol-5-yl)-3-carboxy-2-(2,2-dimethylpent-3-enyl)pyrrolidin-1-yl]acetyl]-butylamino]propyl-trimethylazanium.
| Compound Name | 3-[[2-[(2S,4S)-4-(1,3-benzodioxol-5-yl)-3-carboxy-2-(2,2-dimethylpent-3-enyl)pyrrolidin-1-yl]acetyl]-butylamino]propyl-trimethylazanium |
|---|---|
| PubChem CID | 54461376 |
| Molecular Formula | C31H50N3O5+ |
| Molecular Weight | 544.76 g/mol |
| Exact Mass | 544.37 |
| IUPAC Name | 3-[[2-[(2S,4S)-4-(1,3-benzodioxol-5-yl)-3-carboxy-2-(2,2-dimethylpent-3-enyl)pyrrolidin-1-yl]acetyl]-butylamino]propyl-trimethylazanium |
| SMILES | CC=CC(C)(C)C[C@H]1C(C(=O)O)[C@@H](c2ccc3c(c2)OCO3)CN1CC(=O)N(CCCC)CCC[N+](C)(C)C |
| InChI | InChI=1S/C31H49N3O5/c1-8-10-15-32(16-11-17-34(5,6)7)28(35)21-33-20-24(23-12-13-26-27(18-23)39-22-38-26)29(30(36)37)25(33)19-31(3,4)14-9-2/h9,12-14,18,24-25,29H,8,10-11,15-17,19-22H2,1-7H3/p+1/t24-,25+,29?/m1/s1 |
| InChIKey | XBVVKJRJJQDEMR-SYXMPNKISA-O |
| XLogP | 4.60 |
| TPSA | 79.31 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 544.76 |
| LogP ≤ 5 | 4.60 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|