C30H47N3O4 — CID 54150974
(2S,4S)-1-[2-[4-aminobutyl(butyl)amino]-2-oxoethyl]-4-(2,3-dihydro-1-benzofuran-5-yl)-2-(2,2-dimethylpent-3-enyl)pyrrolidine-3-carboxylic acid (PubChem CID 54150974) has the molecular formula C30H47N3O4 and a molecular weight of 513.72 g/mol. Its IUPAC name is (2S,4S)-1-[2-[4-aminobutyl(butyl)amino]-2-oxoethyl]-4-(2,3-dihydro-1-benzofuran-5-yl)-2-(2,2-dimethylpent-3-enyl)pyrrolidine-3-carboxylic acid.
| Compound Name | (2S,4S)-1-[2-[4-aminobutyl(butyl)amino]-2-oxoethyl]-4-(2,3-dihydro-1-benzofuran-5-yl)-2-(2,2-dimethylpent-3-enyl)pyrrolidine-3-carboxylic acid |
|---|---|
| PubChem CID | 54150974 |
| Molecular Formula | C30H47N3O4 |
| Molecular Weight | 513.72 g/mol |
| Exact Mass | 513.36 |
| IUPAC Name | (2S,4S)-1-[2-[4-aminobutyl(butyl)amino]-2-oxoethyl]-4-(2,3-dihydro-1-benzofuran-5-yl)-2-(2,2-dimethylpent-3-enyl)pyrrolidine-3-carboxylic acid |
| SMILES | CC=CC(C)(C)C[C@H]1C(C(=O)O)[C@@H](c2ccc3c(c2)CCO3)CN1CC(=O)N(CCCC)CCCCN |
| InChI | InChI=1S/C30H47N3O4/c1-5-7-15-32(16-9-8-14-31)27(34)21-33-20-24(22-10-11-26-23(18-22)12-17-37-26)28(29(35)36)25(33)19-30(3,4)13-6-2/h6,10-11,13,18,24-25,28H,5,7-9,12,14-17,19-21,31H2,1-4H3,(H,35,36)/t24-,25+,28?/m1/s1 |
| InChIKey | OHSFVHAMRLZSCI-CRWLQCRJSA-N |
| XLogP | 4.45 |
| TPSA | 96.10 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 513.72 |
| LogP ≤ 5 | 4.45 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|