C28H42N2O5 — CID 58849050
(2S,3R,4S)-4-(2,3-dihydro-1-benzofuran-5-yl)-2-[(E)-2,2-dimethylpent-3-enyl]-1-[2-oxo-2-[propoxy(propyl)amino]ethyl]pyrrolidine-3-carboxylic acid (PubChem CID 58849050) has the molecular formula C28H42N2O5 and a molecular weight of 486.65 g/mol. Its IUPAC name is (2S,3R,4S)-4-(2,3-dihydro-1-benzofuran-5-yl)-2-[(E)-2,2-dimethylpent-3-enyl]-1-[2-oxo-2-[propoxy(propyl)amino]ethyl]pyrrolidine-3-carboxylic acid.
| Compound Name | (2S,3R,4S)-4-(2,3-dihydro-1-benzofuran-5-yl)-2-[(E)-2,2-dimethylpent-3-enyl]-1-[2-oxo-2-[propoxy(propyl)amino]ethyl]pyrrolidine-3-carboxylic acid |
|---|---|
| PubChem CID | 58849050 |
| Molecular Formula | C28H42N2O5 |
| Molecular Weight | 486.65 g/mol |
| Exact Mass | 486.31 |
| IUPAC Name | (2S,3R,4S)-4-(2,3-dihydro-1-benzofuran-5-yl)-2-[(E)-2,2-dimethylpent-3-enyl]-1-[2-oxo-2-[propoxy(propyl)amino]ethyl]pyrrolidine-3-carboxylic acid |
| SMILES | C/C=C/C(C)(C)C[C@H]1[C@H](C(=O)O)[C@@H](c2ccc3c(c2)CCO3)CN1CC(=O)N(CCC)OCCC |
| InChI | InChI=1S/C28H42N2O5/c1-6-12-28(4,5)17-23-26(27(32)33)22(20-9-10-24-21(16-20)11-15-34-24)18-29(23)19-25(31)30(13-7-2)35-14-8-3/h6,9-10,12,16,22-23,26H,7-8,11,13-15,17-19H2,1-5H3,(H,32,33)/b12-6+/t22-,23+,26-/m1/s1 |
| InChIKey | UYSVGSMLJXLRQK-DOEOIYOISA-N |
| XLogP | 4.66 |
| TPSA | 79.31 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 486.65 |
| LogP ≤ 5 | 4.66 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|