C25H39N3O7 — CID 163712924
(2S,3R,4S)-4-(1,3-benzodioxol-5-yl)-2-[2-[1-hydroxyethyl(methyl)amino]ethyl]-1-[2-oxo-2-[propoxy(propyl)amino]ethyl]pyrrolidine-3-carboxylic acid (PubChem CID 163712924) has the molecular formula C25H39N3O7 and a molecular weight of 493.60 g/mol. Its IUPAC name is (2S,3R,4S)-4-(1,3-benzodioxol-5-yl)-2-[2-[1-hydroxyethyl(methyl)amino]ethyl]-1-[2-oxo-2-[propoxy(propyl)amino]ethyl]pyrrolidine-3-carboxylic acid.
| Compound Name | (2S,3R,4S)-4-(1,3-benzodioxol-5-yl)-2-[2-[1-hydroxyethyl(methyl)amino]ethyl]-1-[2-oxo-2-[propoxy(propyl)amino]ethyl]pyrrolidine-3-carboxylic acid |
|---|---|
| PubChem CID | 163712924 |
| Molecular Formula | C25H39N3O7 |
| Molecular Weight | 493.60 g/mol |
| Exact Mass | 493.28 |
| IUPAC Name | (2S,3R,4S)-4-(1,3-benzodioxol-5-yl)-2-[2-[1-hydroxyethyl(methyl)amino]ethyl]-1-[2-oxo-2-[propoxy(propyl)amino]ethyl]pyrrolidine-3-carboxylic acid |
| SMILES | CCCON(CCC)C(=O)CN1C[C@H](c2ccc3c(c2)OCO3)[C@@H](C(=O)O)[C@@H]1CCN(C)C(C)O |
| InChI | InChI=1S/C25H39N3O7/c1-5-10-28(35-12-6-2)23(30)15-27-14-19(18-7-8-21-22(13-18)34-16-33-21)24(25(31)32)20(27)9-11-26(4)17(3)29/h7-8,13,17,19-20,24,29H,5-6,9-12,14-16H2,1-4H3,(H,31,32)/t17?,19-,20+,24-/m1/s1 |
| InChIKey | KKVWADHVIJKCEC-SBIVKBSGSA-N |
| XLogP | 2.12 |
| TPSA | 112.01 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 493.60 |
| LogP ≤ 5 | 2.12 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|