C26H42N2O6S — CID 22322701
methyl 4-(1,3-benzodioxol-5-yl)-2-pentyl-1-[2-[propyl(propylsulfonyl)amino]ethyl]pyrrolidine-3-carboxylate (PubChem CID 22322701) has the molecular formula C26H42N2O6S and a molecular weight of 510.70 g/mol. Its IUPAC name is methyl 4-(1,3-benzodioxol-5-yl)-2-pentyl-1-[2-[propyl(propylsulfonyl)amino]ethyl]pyrrolidine-3-carboxylate.
| Compound Name | methyl 4-(1,3-benzodioxol-5-yl)-2-pentyl-1-[2-[propyl(propylsulfonyl)amino]ethyl]pyrrolidine-3-carboxylate |
|---|---|
| PubChem CID | 22322701 |
| Molecular Formula | C26H42N2O6S |
| Molecular Weight | 510.70 g/mol |
| Exact Mass | 510.28 |
| IUPAC Name | methyl 4-(1,3-benzodioxol-5-yl)-2-pentyl-1-[2-[propyl(propylsulfonyl)amino]ethyl]pyrrolidine-3-carboxylate |
| SMILES | CCCCCC1C(C(=O)OC)C(c2ccc3c(c2)OCO3)CN1CCN(CCC)S(=O)(=O)CCC |
| InChI | InChI=1S/C26H42N2O6S/c1-5-8-9-10-22-25(26(29)32-4)21(20-11-12-23-24(17-20)34-19-33-23)18-27(22)14-15-28(13-6-2)35(30,31)16-7-3/h11-12,17,21-22,25H,5-10,13-16,18-19H2,1-4H3 |
| InChIKey | WPTFUMLSPFGWFC-UHFFFAOYSA-N |
| XLogP | 4.00 |
| TPSA | 85.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 510.70 |
| LogP ≤ 5 | 4.00 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|