C20H28BrNO4 — CID 22322982
methyl 4-(1,3-benzodioxol-5-yl)-1-(2-bromoethyl)-2-pentylpyrrolidine-3-carboxylate (PubChem CID 22322982) has the molecular formula C20H28BrNO4 and a molecular weight of 426.35 g/mol. Its IUPAC name is methyl 4-(1,3-benzodioxol-5-yl)-1-(2-bromoethyl)-2-pentylpyrrolidine-3-carboxylate.
| Compound Name | methyl 4-(1,3-benzodioxol-5-yl)-1-(2-bromoethyl)-2-pentylpyrrolidine-3-carboxylate |
|---|---|
| PubChem CID | 22322982 |
| Molecular Formula | C20H28BrNO4 |
| Molecular Weight | 426.35 g/mol |
| Exact Mass | 425.12 |
| IUPAC Name | methyl 4-(1,3-benzodioxol-5-yl)-1-(2-bromoethyl)-2-pentylpyrrolidine-3-carboxylate |
| SMILES | CCCCCC1C(C(=O)OC)C(c2ccc3c(c2)OCO3)CN1CCBr |
| InChI | InChI=1S/C20H28BrNO4/c1-3-4-5-6-16-19(20(23)24-2)15(12-22(16)10-9-21)14-7-8-17-18(11-14)26-13-25-17/h7-8,11,15-16,19H,3-6,9-10,12-13H2,1-2H3 |
| InChIKey | VERIMWCCUXXXEI-UHFFFAOYSA-N |
| XLogP | 3.95 |
| TPSA | 48.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 426.35 |
| LogP ≤ 5 | 3.95 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|