C17H23NO5 — CID 87761423
4-(1,3-benzodioxol-5-yl)-2-(2-ethoxyethyl)-1-methylpyrrolidine-3-carboxylic acid (PubChem CID 87761423) has the molecular formula C17H23NO5 and a molecular weight of 321.37 g/mol. Its IUPAC name is 4-(1,3-benzodioxol-5-yl)-2-(2-ethoxyethyl)-1-methylpyrrolidine-3-carboxylic acid.
| Compound Name | 4-(1,3-benzodioxol-5-yl)-2-(2-ethoxyethyl)-1-methylpyrrolidine-3-carboxylic acid |
|---|---|
| PubChem CID | 87761423 |
| Molecular Formula | C17H23NO5 |
| Molecular Weight | 321.37 g/mol |
| Exact Mass | 321.16 |
| IUPAC Name | 4-(1,3-benzodioxol-5-yl)-2-(2-ethoxyethyl)-1-methylpyrrolidine-3-carboxylic acid |
| SMILES | CCOCCC1C(C(=O)O)C(c2ccc3c(c2)OCO3)CN1C |
| InChI | InChI=1S/C17H23NO5/c1-3-21-7-6-13-16(17(19)20)12(9-18(13)2)11-4-5-14-15(8-11)23-10-22-14/h4-5,8,12-13,16H,3,6-7,9-10H2,1-2H3,(H,19,20) |
| InChIKey | NYYLUUHFIHPFSS-UHFFFAOYSA-N |
| XLogP | 1.94 |
| TPSA | 68.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 321.37 |
| LogP ≤ 5 | 1.94 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|