C23H27NO7 — CID 87828309
4-(1,3-benzodioxol-5-yl)-2-[4-methoxy-2-(2-methoxyethoxy)phenyl]-1-methylpyrrolidine-3-carboxylic acid (PubChem CID 87828309) has the molecular formula C23H27NO7 and a molecular weight of 429.47 g/mol. Its IUPAC name is 4-(1,3-benzodioxol-5-yl)-2-[4-methoxy-2-(2-methoxyethoxy)phenyl]-1-methylpyrrolidine-3-carboxylic acid.
| Compound Name | 4-(1,3-benzodioxol-5-yl)-2-[4-methoxy-2-(2-methoxyethoxy)phenyl]-1-methylpyrrolidine-3-carboxylic acid |
|---|---|
| PubChem CID | 87828309 |
| Molecular Formula | C23H27NO7 |
| Molecular Weight | 429.47 g/mol |
| Exact Mass | 429.18 |
| IUPAC Name | 4-(1,3-benzodioxol-5-yl)-2-[4-methoxy-2-(2-methoxyethoxy)phenyl]-1-methylpyrrolidine-3-carboxylic acid |
| SMILES | COCCOc1cc(OC)ccc1C1C(C(=O)O)C(c2ccc3c(c2)OCO3)CN1C |
| InChI | InChI=1S/C23H27NO7/c1-24-12-17(14-4-7-18-20(10-14)31-13-30-18)21(23(25)26)22(24)16-6-5-15(28-3)11-19(16)29-9-8-27-2/h4-7,10-11,17,21-22H,8-9,12-13H2,1-3H3,(H,25,26) |
| InChIKey | AFRGNWTZDZPPSU-UHFFFAOYSA-N |
| XLogP | 2.92 |
| TPSA | 86.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 429.47 |
| LogP ≤ 5 | 2.92 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|