C25H31NO7 — CID 67690603
(4R,5S)-3-(1,3-benzodioxol-5-yl)-1-[2-(2-methoxyethoxy)ethyl]-5-(4-methoxyphenyl)piperidine-4-carboxylic acid (PubChem CID 67690603) has the molecular formula C25H31NO7 and a molecular weight of 457.52 g/mol. Its IUPAC name is (4R,5S)-3-(1,3-benzodioxol-5-yl)-1-[2-(2-methoxyethoxy)ethyl]-5-(4-methoxyphenyl)piperidine-4-carboxylic acid.
| Compound Name | (4R,5S)-3-(1,3-benzodioxol-5-yl)-1-[2-(2-methoxyethoxy)ethyl]-5-(4-methoxyphenyl)piperidine-4-carboxylic acid |
|---|---|
| PubChem CID | 67690603 |
| Molecular Formula | C25H31NO7 |
| Molecular Weight | 457.52 g/mol |
| Exact Mass | 457.21 |
| IUPAC Name | (4R,5S)-3-(1,3-benzodioxol-5-yl)-1-[2-(2-methoxyethoxy)ethyl]-5-(4-methoxyphenyl)piperidine-4-carboxylic acid |
| SMILES | COCCOCCN1CC(c2ccc3c(c2)OCO3)[C@H](C(=O)O)[C@@H](c2ccc(OC)cc2)C1 |
| InChI | InChI=1S/C25H31NO7/c1-29-11-12-31-10-9-26-14-20(17-3-6-19(30-2)7-4-17)24(25(27)28)21(15-26)18-5-8-22-23(13-18)33-16-32-22/h3-8,13,20-21,24H,9-12,14-16H2,1-2H3,(H,27,28)/t20-,21?,24-/m1/s1 |
| InChIKey | WYURJIDIKIKYGB-JUOXGZAWSA-N |
| XLogP | 2.97 |
| TPSA | 86.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 457.52 |
| LogP ≤ 5 | 2.97 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|