C27H36N2O6 — CID 87761854
3-(1,3-benzodioxol-5-yl)-5-(4-methoxyphenyl)-1-methylpiperidine-4-carboxylic acid;N-butyl-N-methylformamide (PubChem CID 87761854) has the molecular formula C27H36N2O6 and a molecular weight of 484.59 g/mol. Its IUPAC name is 3-(1,3-benzodioxol-5-yl)-5-(4-methoxyphenyl)-1-methylpiperidine-4-carboxylic acid;N-butyl-N-methylformamide.
| Compound Name | 3-(1,3-benzodioxol-5-yl)-5-(4-methoxyphenyl)-1-methylpiperidine-4-carboxylic acid;N-butyl-N-methylformamide |
|---|---|
| PubChem CID | 87761854 |
| Molecular Formula | C27H36N2O6 |
| Molecular Weight | 484.59 g/mol |
| Exact Mass | 484.26 |
| IUPAC Name | 3-(1,3-benzodioxol-5-yl)-5-(4-methoxyphenyl)-1-methylpiperidine-4-carboxylic acid;N-butyl-N-methylformamide |
| SMILES | CCCCN(C)C=O.COc1ccc(C2CN(C)CC(c3ccc4c(c3)OCO4)C2C(=O)O)cc1 |
| InChI | InChI=1S/C21H23NO5.C6H13NO/c1-22-10-16(13-3-6-15(25-2)7-4-13)20(21(23)24)17(11-22)14-5-8-18-19(9-14)27-12-26-18;1-3-4-5-7(2)6-8/h3-9,16-17,20H,10-12H2,1-2H3,(H,23,24);6H,3-5H2,1-2H3 |
| InChIKey | LBUXRNDJHIBFCI-UHFFFAOYSA-N |
| XLogP | 3.81 |
| TPSA | 88.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 484.59 |
| LogP ≤ 5 | 3.81 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|