C25H31NO6 — CID 70110614
(2S,3S)-4-(1,3-benzodioxol-5-yl)-2-(4-methoxyphenyl)-1-(3-propan-2-yloxypropyl)pyrrolidine-3-carboxylic acid (PubChem CID 70110614) has the molecular formula C25H31NO6 and a molecular weight of 441.52 g/mol. Its IUPAC name is (2S,3S)-4-(1,3-benzodioxol-5-yl)-2-(4-methoxyphenyl)-1-(3-propan-2-yloxypropyl)pyrrolidine-3-carboxylic acid.
| Compound Name | (2S,3S)-4-(1,3-benzodioxol-5-yl)-2-(4-methoxyphenyl)-1-(3-propan-2-yloxypropyl)pyrrolidine-3-carboxylic acid |
|---|---|
| PubChem CID | 70110614 |
| Molecular Formula | C25H31NO6 |
| Molecular Weight | 441.52 g/mol |
| Exact Mass | 441.22 |
| IUPAC Name | (2S,3S)-4-(1,3-benzodioxol-5-yl)-2-(4-methoxyphenyl)-1-(3-propan-2-yloxypropyl)pyrrolidine-3-carboxylic acid |
| SMILES | COc1ccc([C@@H]2[C@@H](C(=O)O)C(c3ccc4c(c3)OCO4)CN2CCCOC(C)C)cc1 |
| InChI | InChI=1S/C25H31NO6/c1-16(2)30-12-4-11-26-14-20(18-7-10-21-22(13-18)32-15-31-21)23(25(27)28)24(26)17-5-8-19(29-3)9-6-17/h5-10,13,16,20,23-24H,4,11-12,14-15H2,1-3H3,(H,27,28)/t20?,23-,24+/m0/s1 |
| InChIKey | JAHIREHHDRNFPF-VXSFFCHMSA-N |
| XLogP | 4.08 |
| TPSA | 77.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 441.52 |
| LogP ≤ 5 | 4.08 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|