C26H31NO5 — CID 54518361
(2S,3S)-4-(1,3-benzodioxol-5-yl)-2-(4-methoxyphenyl)-1-(5-methylhex-4-enyl)pyrrolidine-3-carboxylic acid (PubChem CID 54518361) has the molecular formula C26H31NO5 and a molecular weight of 437.54 g/mol. Its IUPAC name is (2S,3S)-4-(1,3-benzodioxol-5-yl)-2-(4-methoxyphenyl)-1-(5-methylhex-4-enyl)pyrrolidine-3-carboxylic acid.
| Compound Name | (2S,3S)-4-(1,3-benzodioxol-5-yl)-2-(4-methoxyphenyl)-1-(5-methylhex-4-enyl)pyrrolidine-3-carboxylic acid |
|---|---|
| PubChem CID | 54518361 |
| Molecular Formula | C26H31NO5 |
| Molecular Weight | 437.54 g/mol |
| Exact Mass | 437.22 |
| IUPAC Name | (2S,3S)-4-(1,3-benzodioxol-5-yl)-2-(4-methoxyphenyl)-1-(5-methylhex-4-enyl)pyrrolidine-3-carboxylic acid |
| SMILES | COc1ccc([C@@H]2[C@@H](C(=O)O)C(c3ccc4c(c3)OCO4)CN2CCCC=C(C)C)cc1 |
| InChI | InChI=1S/C26H31NO5/c1-17(2)6-4-5-13-27-15-21(19-9-12-22-23(14-19)32-16-31-22)24(26(28)29)25(27)18-7-10-20(30-3)11-8-18/h6-12,14,21,24-25H,4-5,13,15-16H2,1-3H3,(H,28,29)/t21?,24-,25+/m0/s1 |
| InChIKey | YNZNUOHHEDZDAI-DYCCLRLQSA-N |
| XLogP | 5.01 |
| TPSA | 68.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 437.54 |
| LogP ≤ 5 | 5.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|