C28H44N2O5 — CID 173153676
4-(1,3-benzodioxol-5-yl)-1-methyl-2-(3-methylpent-3-enyl)pyrrolidine-3-carboxylic acid;N,N-dibutylformamide (PubChem CID 173153676) has the molecular formula C28H44N2O5 and a molecular weight of 488.67 g/mol. Its IUPAC name is 4-(1,3-benzodioxol-5-yl)-1-methyl-2-(3-methylpent-3-enyl)pyrrolidine-3-carboxylic acid;N,N-dibutylformamide.
| Compound Name | 4-(1,3-benzodioxol-5-yl)-1-methyl-2-(3-methylpent-3-enyl)pyrrolidine-3-carboxylic acid;N,N-dibutylformamide |
|---|---|
| PubChem CID | 173153676 |
| Molecular Formula | C28H44N2O5 |
| Molecular Weight | 488.67 g/mol |
| Exact Mass | 488.33 |
| IUPAC Name | 4-(1,3-benzodioxol-5-yl)-1-methyl-2-(3-methylpent-3-enyl)pyrrolidine-3-carboxylic acid;N,N-dibutylformamide |
| SMILES | CC=C(C)CCC1C(C(=O)O)C(c2ccc3c(c2)OCO3)CN1C.CCCCN(C=O)CCCC |
| InChI | InChI=1S/C19H25NO4.C9H19NO/c1-4-12(2)5-7-15-18(19(21)22)14(10-20(15)3)13-6-8-16-17(9-13)24-11-23-16;1-3-5-7-10(9-11)8-6-4-2/h4,6,8-9,14-15,18H,5,7,10-11H2,1-3H3,(H,21,22);9H,3-8H2,1-2H3 |
| InChIKey | DAIJNHIRSFZUPH-UHFFFAOYSA-N |
| XLogP | 5.31 |
| TPSA | 79.31 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 488.67 |
| LogP ≤ 5 | 5.31 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|