C28H40N2O6 — CID 87761831
4-(1,3-benzodioxol-5-yl)-2-(5-ethylfuran-2-yl)-1-methylpyrrolidine-3-carboxylic acid;N,N-dibutylformamide (PubChem CID 87761831) has the molecular formula C28H40N2O6 and a molecular weight of 500.64 g/mol. Its IUPAC name is 4-(1,3-benzodioxol-5-yl)-2-(5-ethylfuran-2-yl)-1-methylpyrrolidine-3-carboxylic acid;N,N-dibutylformamide.
| Compound Name | 4-(1,3-benzodioxol-5-yl)-2-(5-ethylfuran-2-yl)-1-methylpyrrolidine-3-carboxylic acid;N,N-dibutylformamide |
|---|---|
| PubChem CID | 87761831 |
| Molecular Formula | C28H40N2O6 |
| Molecular Weight | 500.64 g/mol |
| Exact Mass | 500.29 |
| IUPAC Name | 4-(1,3-benzodioxol-5-yl)-2-(5-ethylfuran-2-yl)-1-methylpyrrolidine-3-carboxylic acid;N,N-dibutylformamide |
| SMILES | CCCCN(C=O)CCCC.CCc1ccc(C2C(C(=O)O)C(c3ccc4c(c3)OCO4)CN2C)o1 |
| InChI | InChI=1S/C19H21NO5.C9H19NO/c1-3-12-5-7-15(25-12)18-17(19(21)22)13(9-20(18)2)11-4-6-14-16(8-11)24-10-23-14;1-3-5-7-10(9-11)8-6-4-2/h4-8,13,17-18H,3,9-10H2,1-2H3,(H,21,22);9H,3-8H2,1-2H3 |
| InChIKey | ARTSCSQDHIFVMN-UHFFFAOYSA-N |
| XLogP | 5.09 |
| TPSA | 92.45 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 500.64 |
| LogP ≤ 5 | 5.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|