C21H34N2O3 — CID 166652855
2-(1,3-benzodioxol-5-yl)-1-methylpyrrolidine;N,N-dibutylformamide (PubChem CID 166652855) has the molecular formula C21H34N2O3 and a molecular weight of 362.51 g/mol. Its IUPAC name is 2-(1,3-benzodioxol-5-yl)-1-methylpyrrolidine;N,N-dibutylformamide.
| Compound Name | 2-(1,3-benzodioxol-5-yl)-1-methylpyrrolidine;N,N-dibutylformamide |
|---|---|
| PubChem CID | 166652855 |
| Molecular Formula | C21H34N2O3 |
| Molecular Weight | 362.51 g/mol |
| Exact Mass | 362.26 |
| IUPAC Name | 2-(1,3-benzodioxol-5-yl)-1-methylpyrrolidine;N,N-dibutylformamide |
| SMILES | CCCCN(C=O)CCCC.CN1CCCC1c1ccc2c(c1)OCO2 |
| InChI | InChI=1S/C12H15NO2.C9H19NO/c1-13-6-2-3-10(13)9-4-5-11-12(7-9)15-8-14-11;1-3-5-7-10(9-11)8-6-4-2/h4-5,7,10H,2-3,6,8H2,1H3;9H,3-8H2,1-2H3 |
| InChIKey | ICXDSOSYEREHLP-UHFFFAOYSA-N |
| XLogP | 4.23 |
| TPSA | 42.01 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 362.51 |
| LogP ≤ 5 | 4.23 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|