C12H16N2O2 — CID 70977935
2-(1,3-benzodioxol-5-yl)-1-methylpiperazine (PubChem CID 70977935) has the molecular formula C12H16N2O2 and a molecular weight of 220.27 g/mol. Its IUPAC name is 2-(1,3-benzodioxol-5-yl)-1-methylpiperazine.
| Compound Name | 2-(1,3-benzodioxol-5-yl)-1-methylpiperazine |
|---|---|
| PubChem CID | 70977935 |
| Molecular Formula | C12H16N2O2 |
| Molecular Weight | 220.27 g/mol |
| Exact Mass | 220.12 |
| IUPAC Name | 2-(1,3-benzodioxol-5-yl)-1-methylpiperazine |
| SMILES | CN1CCNCC1c1ccc2c(c1)OCO2 |
| InChI | InChI=1S/C12H16N2O2/c1-14-5-4-13-7-10(14)9-2-3-11-12(6-9)16-8-15-11/h2-3,6,10,13H,4-5,7-8H2,1H3 |
| InChIKey | FMJRMXLPIUZMSZ-UHFFFAOYSA-N |
| XLogP | 0.99 |
| TPSA | 33.73 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 220.27 |
| LogP ≤ 5 | 0.99 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |