C12H20N4 — CID 131540861
N,N-dimethyl-5-(1-methylpiperazin-2-yl)pyridin-2-amine (PubChem CID 131540861) has the molecular formula C12H20N4 and a molecular weight of 220.32 g/mol. Its IUPAC name is N,N-dimethyl-5-(1-methylpiperazin-2-yl)pyridin-2-amine.
| Compound Name | N,N-dimethyl-5-(1-methylpiperazin-2-yl)pyridin-2-amine |
|---|---|
| PubChem CID | 131540861 |
| Molecular Formula | C12H20N4 |
| Molecular Weight | 220.32 g/mol |
| Exact Mass | 220.17 |
| IUPAC Name | N,N-dimethyl-5-(1-methylpiperazin-2-yl)pyridin-2-amine |
| SMILES | CN(C)c1ccc(C2CNCCN2C)cn1 |
| InChI | InChI=1S/C12H20N4/c1-15(2)12-5-4-10(8-14-12)11-9-13-6-7-16(11)3/h4-5,8,11,13H,6-7,9H2,1-3H3 |
| InChIKey | SJCYVGNURZWMHQ-UHFFFAOYSA-N |
| XLogP | 0.72 |
| TPSA | 31.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 220.32 |
| LogP ≤ 5 | 0.72 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |