C25H38N2O6 — CID 173153907
4-(1,3-benzodioxol-5-yl)-2-(3-hydroxyprop-1-enyl)-1-methylpyrrolidine-3-carboxylic acid;N,N-dibutylformamide (PubChem CID 173153907) has the molecular formula C25H38N2O6 and a molecular weight of 462.59 g/mol. Its IUPAC name is 4-(1,3-benzodioxol-5-yl)-2-(3-hydroxyprop-1-enyl)-1-methylpyrrolidine-3-carboxylic acid;N,N-dibutylformamide.
| Compound Name | 4-(1,3-benzodioxol-5-yl)-2-(3-hydroxyprop-1-enyl)-1-methylpyrrolidine-3-carboxylic acid;N,N-dibutylformamide |
|---|---|
| PubChem CID | 173153907 |
| Molecular Formula | C25H38N2O6 |
| Molecular Weight | 462.59 g/mol |
| Exact Mass | 462.27 |
| IUPAC Name | 4-(1,3-benzodioxol-5-yl)-2-(3-hydroxyprop-1-enyl)-1-methylpyrrolidine-3-carboxylic acid;N,N-dibutylformamide |
| SMILES | CCCCN(C=O)CCCC.CN1CC(c2ccc3c(c2)OCO3)C(C(=O)O)C1C=CCO |
| InChI | InChI=1S/C16H19NO5.C9H19NO/c1-17-8-11(15(16(19)20)12(17)3-2-6-18)10-4-5-13-14(7-10)22-9-21-13;1-3-5-7-10(9-11)8-6-4-2/h2-5,7,11-12,15,18H,6,8-9H2,1H3,(H,19,20);9H,3-8H2,1-2H3 |
| InChIKey | LPRPQGRCQBMASF-UHFFFAOYSA-N |
| XLogP | 3.11 |
| TPSA | 99.54 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 462.59 |
| LogP ≤ 5 | 3.11 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|