C24H27NO3 — CID 122227062
ethyl (5E,7S,8S)-1-benzyl-9-oxo-8-phenyl-3,4,7,8-tetrahydro-2H-azonine-7-carboxylate (PubChem CID 122227062) has the molecular formula C24H27NO3 and a molecular weight of 377.48 g/mol. Its IUPAC name is ethyl (5E,7S,8S)-1-benzyl-9-oxo-8-phenyl-3,4,7,8-tetrahydro-2H-azonine-7-carboxylate.
| Compound Name | ethyl (5E,7S,8S)-1-benzyl-9-oxo-8-phenyl-3,4,7,8-tetrahydro-2H-azonine-7-carboxylate |
|---|---|
| PubChem CID | 122227062 |
| Molecular Formula | C24H27NO3 |
| Molecular Weight | 377.48 g/mol |
| Exact Mass | 377.20 |
| IUPAC Name | ethyl (5E,7S,8S)-1-benzyl-9-oxo-8-phenyl-3,4,7,8-tetrahydro-2H-azonine-7-carboxylate |
| SMILES | CCOC(=O)[C@H]1/C=C/CCCN(Cc2ccccc2)C(=O)[C@@H]1c1ccccc1 |
| InChI | InChI=1S/C24H27NO3/c1-2-28-24(27)21-16-10-5-11-17-25(18-19-12-6-3-7-13-19)23(26)22(21)20-14-8-4-9-15-20/h3-4,6-10,12-16,21-22H,2,5,11,17-18H2,1H3/b16-10+/t21-,22+/m0/s1 |
| InChIKey | AUFDNPXCGHIXDL-XAYCBPNJSA-N |
| XLogP | 4.33 |
| TPSA | 46.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 377.48 |
| LogP ≤ 5 | 4.33 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|