About benzyl 5-oxo-2,3,6,7-tetrahydro-1H-pyrrolizine-8-carboxylate
benzyl 5-oxo-2,3,6,7-tetrahydro-1H-pyrrolizine-8-carboxylate (PubChem CID 71436087) has the molecular formula C15H17NO3
and a molecular weight of 259.30 g/mol. Its IUPAC name is benzyl 5-oxo-2,3,6,7-tetrahydro-1H-pyrrolizine-8-carboxylate.
Analyze benzyl 5-oxo-2,3,6,7-tetrahydro-1H-pyrrolizine-8-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of benzyl 5-oxo-2,3,6,7-tetrahydro-1H-pyrrolizine-8-carboxylate?
The IUPAC name of benzyl 5-oxo-2,3,6,7-tetrahydro-1H-pyrrolizine-8-carboxylate (CID 71436087) is benzyl 5-oxo-2,3,6,7-tetrahydro-1H-pyrrolizine-8-carboxylate.
What is the SMILES notation for benzyl 5-oxo-2,3,6,7-tetrahydro-1H-pyrrolizine-8-carboxylate?
The canonical SMILES for benzyl 5-oxo-2,3,6,7-tetrahydro-1H-pyrrolizine-8-carboxylate is O=C1CCC2(C(=O)OCc3ccccc3)CCCN12.
What is the InChIKey of benzyl 5-oxo-2,3,6,7-tetrahydro-1H-pyrrolizine-8-carboxylate?
The InChIKey is GMIAEBFIBSTTHU-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H17NO3/c17-13-7-9-15(8-4-10-16(13)15)14(18)19-11-12-5-2-1-3-6-12/h1-3,5-6H,4,7-11H2.
What are the key properties of benzyl 5-oxo-2,3,6,7-tetrahydro-1H-pyrrolizine-8-carboxylate?
benzyl 5-oxo-2,3,6,7-tetrahydro-1H-pyrrolizine-8-carboxylate has a molecular weight of 259.30 g/mol, XLogP of 1.88, 3 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for benzyl 5-oxo-2,3,6,7-tetrahydro-1H-pyrrolizine-8-carboxylate is sourced from PubChem (CID 71436087), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).