C21H28N2O3 — CID 142602862
benzyl 1-[3-(dimethylaminomethylidene)-4-oxopiperidin-1-yl]cyclopentane-1-carboxylate (PubChem CID 142602862) has the molecular formula C21H28N2O3 and a molecular weight of 356.47 g/mol. Its IUPAC name is benzyl 1-[3-(dimethylaminomethylidene)-4-oxopiperidin-1-yl]cyclopentane-1-carboxylate.
| Compound Name | benzyl 1-[3-(dimethylaminomethylidene)-4-oxopiperidin-1-yl]cyclopentane-1-carboxylate |
|---|---|
| PubChem CID | 142602862 |
| Molecular Formula | C21H28N2O3 |
| Molecular Weight | 356.47 g/mol |
| Exact Mass | 356.21 |
| IUPAC Name | benzyl 1-[3-(dimethylaminomethylidene)-4-oxopiperidin-1-yl]cyclopentane-1-carboxylate |
| SMILES | CN(C)C=C1CN(C2(C(=O)OCc3ccccc3)CCCC2)CCC1=O |
| InChI | InChI=1S/C21H28N2O3/c1-22(2)14-18-15-23(13-10-19(18)24)21(11-6-7-12-21)20(25)26-16-17-8-4-3-5-9-17/h3-5,8-9,14H,6-7,10-13,15-16H2,1-2H3 |
| InChIKey | GUHNBKWVPFRSHS-UHFFFAOYSA-N |
| XLogP | 2.76 |
| TPSA | 49.85 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 356.47 |
| LogP ≤ 5 | 2.76 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|