C16H16N2O6 — CID 146314138
3-(2,5-dioxopyrrolidin-1-yl)-1-phenylmethoxycarbonylazetidine-3-carboxylic acid (PubChem CID 146314138) has the molecular formula C16H16N2O6 and a molecular weight of 332.31 g/mol. Its IUPAC name is 3-(2,5-dioxopyrrolidin-1-yl)-1-phenylmethoxycarbonylazetidine-3-carboxylic acid.
| Compound Name | 3-(2,5-dioxopyrrolidin-1-yl)-1-phenylmethoxycarbonylazetidine-3-carboxylic acid |
|---|---|
| PubChem CID | 146314138 |
| Molecular Formula | C16H16N2O6 |
| Molecular Weight | 332.31 g/mol |
| Exact Mass | 332.10 |
| IUPAC Name | 3-(2,5-dioxopyrrolidin-1-yl)-1-phenylmethoxycarbonylazetidine-3-carboxylic acid |
| SMILES | O=C(OCc1ccccc1)N1CC(C(=O)O)(N2C(=O)CCC2=O)C1 |
| InChI | InChI=1S/C16H16N2O6/c19-12-6-7-13(20)18(12)16(14(21)22)9-17(10-16)15(23)24-8-11-4-2-1-3-5-11/h1-5H,6-10H2,(H,21,22) |
| InChIKey | MXZCJHCCMIQXNV-UHFFFAOYSA-N |
| XLogP | 0.61 |
| TPSA | 104.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 332.31 |
| LogP ≤ 5 | 0.61 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|