C30H28N2O5 — CID 102316122
ethyl 6-amino-4-(4-methoxyphenyl)-2-oxo-1-phenyl-3-[(E)-3-phenylprop-2-enoyl]-3,4-dihydropyridine-5-carboxylate (PubChem CID 102316122) has the molecular formula C30H28N2O5 and a molecular weight of 496.56 g/mol. Its IUPAC name is ethyl 6-amino-4-(4-methoxyphenyl)-2-oxo-1-phenyl-3-[(E)-3-phenylprop-2-enoyl]-3,4-dihydropyridine-5-carboxylate.
| Compound Name | ethyl 6-amino-4-(4-methoxyphenyl)-2-oxo-1-phenyl-3-[(E)-3-phenylprop-2-enoyl]-3,4-dihydropyridine-5-carboxylate |
|---|---|
| PubChem CID | 102316122 |
| Molecular Formula | C30H28N2O5 |
| Molecular Weight | 496.56 g/mol |
| Exact Mass | 496.20 |
| IUPAC Name | ethyl 6-amino-4-(4-methoxyphenyl)-2-oxo-1-phenyl-3-[(E)-3-phenylprop-2-enoyl]-3,4-dihydropyridine-5-carboxylate |
| SMILES | CCOC(=O)C1=C(N)N(c2ccccc2)C(=O)C(C(=O)/C=C/c2ccccc2)C1c1ccc(OC)cc1 |
| InChI | InChI=1S/C30H28N2O5/c1-3-37-30(35)27-25(21-15-17-23(36-2)18-16-21)26(24(33)19-14-20-10-6-4-7-11-20)29(34)32(28(27)31)22-12-8-5-9-13-22/h4-19,25-26H,3,31H2,1-2H3/b19-14+ |
| InChIKey | YKROXMTWHWVKSE-XMHGGMMESA-N |
| XLogP | 4.46 |
| TPSA | 98.93 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 37 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 496.56 |
| LogP ≤ 5 | 4.46 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|