C23H26O5 — CID 101410968
[(2S,3S)-3-[[(2R,4S,6R)-2-(4-methoxyphenyl)-6-[(E)-2-phenylethenyl]-1,3-dioxan-4-yl]methyl]oxiran-2-yl]methanol (PubChem CID 101410968) has the molecular formula C23H26O5 and a molecular weight of 382.46 g/mol. Its IUPAC name is [(2S,3S)-3-[[(2R,4S,6R)-2-(4-methoxyphenyl)-6-[(E)-2-phenylethenyl]-1,3-dioxan-4-yl]methyl]oxiran-2-yl]methanol.
| Compound Name | [(2S,3S)-3-[[(2R,4S,6R)-2-(4-methoxyphenyl)-6-[(E)-2-phenylethenyl]-1,3-dioxan-4-yl]methyl]oxiran-2-yl]methanol |
|---|---|
| PubChem CID | 101410968 |
| Molecular Formula | C23H26O5 |
| Molecular Weight | 382.46 g/mol |
| Exact Mass | 382.18 |
| IUPAC Name | [(2S,3S)-3-[[(2R,4S,6R)-2-(4-methoxyphenyl)-6-[(E)-2-phenylethenyl]-1,3-dioxan-4-yl]methyl]oxiran-2-yl]methanol |
| SMILES | COc1ccc([C@@H]2O[C@H](C[C@@H]3O[C@H]3CO)C[C@H](/C=C/c3ccccc3)O2)cc1 |
| InChI | InChI=1S/C23H26O5/c1-25-18-11-8-17(9-12-18)23-26-19(10-7-16-5-3-2-4-6-16)13-20(27-23)14-21-22(15-24)28-21/h2-12,19-24H,13-15H2,1H3/b10-7+/t19-,20-,21-,22-,23-/m0/s1 |
| InChIKey | NARSNVFOAYUAKR-WVOUMEJWSA-N |
| XLogP | 3.73 |
| TPSA | 60.45 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 382.46 |
| LogP ≤ 5 | 3.73 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|