C25H38O6 — CID 134843264
tert-butyl (E)-4-[(2S,4R,6R)-4-hydroxy-6-[(2R)-3-[(4-methoxyphenyl)methoxy]-2-methylpropyl]oxan-2-yl]but-2-enoate (PubChem CID 134843264) has the molecular formula C25H38O6 and a molecular weight of 434.57 g/mol. Its IUPAC name is tert-butyl (E)-4-[(2S,4R,6R)-4-hydroxy-6-[(2R)-3-[(4-methoxyphenyl)methoxy]-2-methylpropyl]oxan-2-yl]but-2-enoate.
| Compound Name | tert-butyl (E)-4-[(2S,4R,6R)-4-hydroxy-6-[(2R)-3-[(4-methoxyphenyl)methoxy]-2-methylpropyl]oxan-2-yl]but-2-enoate |
|---|---|
| PubChem CID | 134843264 |
| Molecular Formula | C25H38O6 |
| Molecular Weight | 434.57 g/mol |
| Exact Mass | 434.27 |
| IUPAC Name | tert-butyl (E)-4-[(2S,4R,6R)-4-hydroxy-6-[(2R)-3-[(4-methoxyphenyl)methoxy]-2-methylpropyl]oxan-2-yl]but-2-enoate |
| SMILES | COc1ccc(COC[C@H](C)C[C@@H]2C[C@H](O)C[C@H](C/C=C/C(=O)OC(C)(C)C)O2)cc1 |
| InChI | InChI=1S/C25H38O6/c1-18(16-29-17-19-9-11-21(28-5)12-10-19)13-23-15-20(26)14-22(30-23)7-6-8-24(27)31-25(2,3)4/h6,8-12,18,20,22-23,26H,7,13-17H2,1-5H3/b8-6+/t18-,20-,22+,23-/m1/s1 |
| InChIKey | SAUSIMUYNNMLCO-QQLHVGGQSA-N |
| XLogP | 4.43 |
| TPSA | 74.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 434.57 |
| LogP ≤ 5 | 4.43 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|