C21H36N2O4 — CID 70912107
tert-butyl 2-[[4-[2-[(4-methoxyphenyl)methoxy]ethylamino]-2-methylbutyl]amino]acetate (PubChem CID 70912107) has the molecular formula C21H36N2O4 and a molecular weight of 380.53 g/mol. Its IUPAC name is tert-butyl 2-[[4-[2-[(4-methoxyphenyl)methoxy]ethylamino]-2-methylbutyl]amino]acetate.
| Compound Name | tert-butyl 2-[[4-[2-[(4-methoxyphenyl)methoxy]ethylamino]-2-methylbutyl]amino]acetate |
|---|---|
| PubChem CID | 70912107 |
| Molecular Formula | C21H36N2O4 |
| Molecular Weight | 380.53 g/mol |
| Exact Mass | 380.27 |
| IUPAC Name | tert-butyl 2-[[4-[2-[(4-methoxyphenyl)methoxy]ethylamino]-2-methylbutyl]amino]acetate |
| SMILES | COc1ccc(COCCNCCC(C)CNCC(=O)OC(C)(C)C)cc1 |
| InChI | InChI=1S/C21H36N2O4/c1-17(14-23-15-20(24)27-21(2,3)4)10-11-22-12-13-26-16-18-6-8-19(25-5)9-7-18/h6-9,17,22-23H,10-16H2,1-5H3 |
| InChIKey | WZWTZJBTTVHDKL-UHFFFAOYSA-N |
| XLogP | 2.76 |
| TPSA | 68.82 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 380.53 |
| LogP ≤ 5 | 2.76 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|