C31H52O6Si — CID 134843483
tert-butyl (E)-4-[(2S,4R,6R)-4-[tert-butyl(dimethyl)silyl]oxy-6-[(2R)-3-[(4-methoxyphenyl)methoxy]-2-methylpropyl]oxan-2-yl]but-2-enoate (PubChem CID 134843483) has the molecular formula C31H52O6Si and a molecular weight of 548.84 g/mol. Its IUPAC name is tert-butyl (E)-4-[(2S,4R,6R)-4-[tert-butyl(dimethyl)silyl]oxy-6-[(2R)-3-[(4-methoxyphenyl)methoxy]-2-methylpropyl]oxan-2-yl]but-2-enoate.
| Compound Name | tert-butyl (E)-4-[(2S,4R,6R)-4-[tert-butyl(dimethyl)silyl]oxy-6-[(2R)-3-[(4-methoxyphenyl)methoxy]-2-methylpropyl]oxan-2-yl]but-2-enoate |
|---|---|
| PubChem CID | 134843483 |
| Molecular Formula | C31H52O6Si |
| Molecular Weight | 548.84 g/mol |
| Exact Mass | 548.35 |
| IUPAC Name | tert-butyl (E)-4-[(2S,4R,6R)-4-[tert-butyl(dimethyl)silyl]oxy-6-[(2R)-3-[(4-methoxyphenyl)methoxy]-2-methylpropyl]oxan-2-yl]but-2-enoate |
| SMILES | COc1ccc(COC[C@H](C)C[C@@H]2C[C@H](O[Si](C)(C)C(C)(C)C)C[C@H](C/C=C/C(=O)OC(C)(C)C)O2)cc1 |
| InChI | InChI=1S/C31H52O6Si/c1-23(21-34-22-24-14-16-25(33-8)17-15-24)18-27-20-28(37-38(9,10)31(5,6)7)19-26(35-27)12-11-13-29(32)36-30(2,3)4/h11,13-17,23,26-28H,12,18-22H2,1-10H3/b13-11+/t23-,26+,27-,28-/m1/s1 |
| InChIKey | PQIDAFMRDSANEG-YPPMBQMQSA-N |
| XLogP | 7.46 |
| TPSA | 63.22 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 548.84 |
| LogP ≤ 5 | 7.46 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|