C26H38O3 — CID 11486359
(2R,6R)-2-[(2S)-2,6-dimethylhept-5-enyl]-6-[(Z)-4-[(4-methoxyphenyl)methoxy]but-2-enyl]-3,6-dihydro-2H-pyran (PubChem CID 11486359) has the molecular formula C26H38O3 and a molecular weight of 398.59 g/mol. Its IUPAC name is (2R,6R)-2-[(2S)-2,6-dimethylhept-5-enyl]-6-[(Z)-4-[(4-methoxyphenyl)methoxy]but-2-enyl]-3,6-dihydro-2H-pyran.
| Compound Name | (2R,6R)-2-[(2S)-2,6-dimethylhept-5-enyl]-6-[(Z)-4-[(4-methoxyphenyl)methoxy]but-2-enyl]-3,6-dihydro-2H-pyran |
|---|---|
| PubChem CID | 11486359 |
| Molecular Formula | C26H38O3 |
| Molecular Weight | 398.59 g/mol |
| Exact Mass | 398.28 |
| IUPAC Name | (2R,6R)-2-[(2S)-2,6-dimethylhept-5-enyl]-6-[(Z)-4-[(4-methoxyphenyl)methoxy]but-2-enyl]-3,6-dihydro-2H-pyran |
| SMILES | COc1ccc(COC/C=C\C[C@@H]2C=CC[C@@H](C[C@@H](C)CCC=C(C)C)O2)cc1 |
| InChI | InChI=1S/C26H38O3/c1-21(2)9-7-10-22(3)19-26-13-8-12-25(29-26)11-5-6-18-28-20-23-14-16-24(27-4)17-15-23/h5-6,8-9,12,14-17,22,25-26H,7,10-11,13,18-20H2,1-4H3/b6-5-/t22-,25+,26-/m0/s1 |
| InChIKey | JNZJWLGPULYGBI-KFAIRNTFSA-N |
| XLogP | 6.64 |
| TPSA | 27.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 398.59 |
| LogP ≤ 5 | 6.64 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|