C18H25IO3 — CID 102467318
(1Z,3S,6E)-1-iodo-8-[(4-methoxyphenyl)methoxy]-2,6-dimethylocta-1,6-dien-3-ol (PubChem CID 102467318) has the molecular formula C18H25IO3 and a molecular weight of 416.30 g/mol. Its IUPAC name is (1Z,3S,6E)-1-iodo-8-[(4-methoxyphenyl)methoxy]-2,6-dimethylocta-1,6-dien-3-ol.
| Compound Name | (1Z,3S,6E)-1-iodo-8-[(4-methoxyphenyl)methoxy]-2,6-dimethylocta-1,6-dien-3-ol |
|---|---|
| PubChem CID | 102467318 |
| Molecular Formula | C18H25IO3 |
| Molecular Weight | 416.30 g/mol |
| Exact Mass | 416.08 |
| IUPAC Name | (1Z,3S,6E)-1-iodo-8-[(4-methoxyphenyl)methoxy]-2,6-dimethylocta-1,6-dien-3-ol |
| SMILES | COc1ccc(COC/C=C(\C)CC[C@H](O)/C(C)=C\I)cc1 |
| InChI | InChI=1S/C18H25IO3/c1-14(4-9-18(20)15(2)12-19)10-11-22-13-16-5-7-17(21-3)8-6-16/h5-8,10,12,18,20H,4,9,11,13H2,1-3H3/b14-10+,15-12-/t18-/m0/s1 |
| InChIKey | BYNMPYFYZJIMHQ-WKUUJGQXSA-N |
| XLogP | 4.64 |
| TPSA | 38.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 416.30 |
| LogP ≤ 5 | 4.64 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|