C26H32O6 — CID 132580515
methyl (Z,3R)-3-hydroxy-6-[(4-methoxyphenyl)methoxymethyl]-2-methylidene-8-phenylmethoxyoct-6-enoate (PubChem CID 132580515) has the molecular formula C26H32O6 and a molecular weight of 440.54 g/mol. Its IUPAC name is methyl (Z,3R)-3-hydroxy-6-[(4-methoxyphenyl)methoxymethyl]-2-methylidene-8-phenylmethoxyoct-6-enoate.
| Compound Name | methyl (Z,3R)-3-hydroxy-6-[(4-methoxyphenyl)methoxymethyl]-2-methylidene-8-phenylmethoxyoct-6-enoate |
|---|---|
| PubChem CID | 132580515 |
| Molecular Formula | C26H32O6 |
| Molecular Weight | 440.54 g/mol |
| Exact Mass | 440.22 |
| IUPAC Name | methyl (Z,3R)-3-hydroxy-6-[(4-methoxyphenyl)methoxymethyl]-2-methylidene-8-phenylmethoxyoct-6-enoate |
| SMILES | C=C(C(=O)OC)[C@H](O)CC/C(=C/COCc1ccccc1)COCc1ccc(OC)cc1 |
| InChI | InChI=1S/C26H32O6/c1-20(26(28)30-3)25(27)14-11-23(15-16-31-17-21-7-5-4-6-8-21)19-32-18-22-9-12-24(29-2)13-10-22/h4-10,12-13,15,25,27H,1,11,14,16-19H2,2-3H3/b23-15-/t25-/m1/s1 |
| InChIKey | IUVRNBCMTUQBHC-LWUPDDLQSA-N |
| XLogP | 4.23 |
| TPSA | 74.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 440.54 |
| LogP ≤ 5 | 4.23 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|