C24H26N2O6 — CID 135415159
methyl (4R,5R)-2-diazo-4-[(4-methoxyphenyl)methoxy]-3-oxo-5-(phenylmethoxymethyl)hept-6-enoate (PubChem CID 135415159) has the molecular formula C24H26N2O6 and a molecular weight of 438.48 g/mol. Its IUPAC name is methyl (4R,5R)-2-diazo-4-[(4-methoxyphenyl)methoxy]-3-oxo-5-(phenylmethoxymethyl)hept-6-enoate.
| Compound Name | methyl (4R,5R)-2-diazo-4-[(4-methoxyphenyl)methoxy]-3-oxo-5-(phenylmethoxymethyl)hept-6-enoate |
|---|---|
| PubChem CID | 135415159 |
| Molecular Formula | C24H26N2O6 |
| Molecular Weight | 438.48 g/mol |
| Exact Mass | 438.18 |
| IUPAC Name | methyl (4R,5R)-2-diazo-4-[(4-methoxyphenyl)methoxy]-3-oxo-5-(phenylmethoxymethyl)hept-6-enoate |
| SMILES | C=C[C@H](COCc1ccccc1)[C@@H](OCc1ccc(OC)cc1)C(=O)C(=[N+]=[N-])C(=O)OC |
| InChI | InChI=1S/C24H26N2O6/c1-4-19(16-31-14-17-8-6-5-7-9-17)23(22(27)21(26-25)24(28)30-3)32-15-18-10-12-20(29-2)13-11-18/h4-13,19,23H,1,14-16H2,2-3H3/t19-,23-/m1/s1 |
| InChIKey | UVTCPYAMSJWYHQ-AUSIDOKSSA-N |
| XLogP | 3.01 |
| TPSA | 107.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 438.48 |
| LogP ≤ 5 | 3.01 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'imine_one_A(321)', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|