C24H27N2O6+ — CID 54678981
(2E,4R,5R)-3-hydroxy-1-methoxy-4-[(4-methoxyphenyl)methoxy]-1-oxo-5-(phenylmethoxymethyl)hepta-2,6-diene-2-diazonium (PubChem CID 54678981) has the molecular formula C24H27N2O6+ and a molecular weight of 439.49 g/mol. Its IUPAC name is (2E,4R,5R)-3-hydroxy-1-methoxy-4-[(4-methoxyphenyl)methoxy]-1-oxo-5-(phenylmethoxymethyl)hepta-2,6-diene-2-diazonium.
| Compound Name | (2E,4R,5R)-3-hydroxy-1-methoxy-4-[(4-methoxyphenyl)methoxy]-1-oxo-5-(phenylmethoxymethyl)hepta-2,6-diene-2-diazonium |
|---|---|
| PubChem CID | 54678981 |
| Molecular Formula | C24H27N2O6+ |
| Molecular Weight | 439.49 g/mol |
| Exact Mass | 439.19 |
| IUPAC Name | (2E,4R,5R)-3-hydroxy-1-methoxy-4-[(4-methoxyphenyl)methoxy]-1-oxo-5-(phenylmethoxymethyl)hepta-2,6-diene-2-diazonium |
| SMILES | C=C[C@H](COCc1ccccc1)[C@@H](OCc1ccc(OC)cc1)/C(O)=C(\[N+]#N)C(=O)OC |
| InChI | InChI=1S/C24H26N2O6/c1-4-19(16-31-14-17-8-6-5-7-9-17)23(22(27)21(26-25)24(28)30-3)32-15-18-10-12-20(29-2)13-11-18/h4-13,19,23H,1,14-16H2,2-3H3/p+1/t19-,23-/m1/s1 |
| InChIKey | UVTCPYAMSJWYHQ-AUSIDOKSSA-O |
| XLogP | 4.40 |
| TPSA | 102.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 439.49 |
| LogP ≤ 5 | 4.40 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Azo_group', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|