C17H26O3 — CID 71340836
2,6-dimethyl-8-phenylmethoxyoct-6-ene-2,3-diol (PubChem CID 71340836) has the molecular formula C17H26O3 and a molecular weight of 278.39 g/mol. Its IUPAC name is 2,6-dimethyl-8-phenylmethoxyoct-6-ene-2,3-diol.
| Compound Name | 2,6-dimethyl-8-phenylmethoxyoct-6-ene-2,3-diol |
|---|---|
| PubChem CID | 71340836 |
| Molecular Formula | C17H26O3 |
| Molecular Weight | 278.39 g/mol |
| Exact Mass | 278.19 |
| IUPAC Name | 2,6-dimethyl-8-phenylmethoxyoct-6-ene-2,3-diol |
| SMILES | CC(=CCOCc1ccccc1)CCC(O)C(C)(C)O |
| InChI | InChI=1S/C17H26O3/c1-14(9-10-16(18)17(2,3)19)11-12-20-13-15-7-5-4-6-8-15/h4-8,11,16,18-19H,9-10,12-13H2,1-3H3 |
| InChIKey | XJQJQVZHPATDQZ-UHFFFAOYSA-N |
| XLogP | 3.06 |
| TPSA | 49.69 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 278.39 |
| LogP ≤ 5 | 3.06 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|