C11H19NO3 — CID 124709450
methyl 2-[(2S,3aR,4R,7aR)-4-amino-2,3,3a,4,5,6,7,7a-octahydro-1-benzofuran-2-yl]acetate (PubChem CID 124709450) has the molecular formula C11H19NO3 and a molecular weight of 213.28 g/mol. Its IUPAC name is methyl 2-[(2S,3aR,4R,7aR)-4-amino-2,3,3a,4,5,6,7,7a-octahydro-1-benzofuran-2-yl]acetate.
| Compound Name | methyl 2-[(2S,3aR,4R,7aR)-4-amino-2,3,3a,4,5,6,7,7a-octahydro-1-benzofuran-2-yl]acetate |
|---|---|
| PubChem CID | 124709450 |
| Molecular Formula | C11H19NO3 |
| Molecular Weight | 213.28 g/mol |
| Exact Mass | 213.14 |
| IUPAC Name | methyl 2-[(2S,3aR,4R,7aR)-4-amino-2,3,3a,4,5,6,7,7a-octahydro-1-benzofuran-2-yl]acetate |
| SMILES | COC(=O)C[C@@H]1C[C@@H]2[C@H](N)CCC[C@H]2O1 |
| InChI | InChI=1S/C11H19NO3/c1-14-11(13)6-7-5-8-9(12)3-2-4-10(8)15-7/h7-10H,2-6,12H2,1H3/t7-,8+,9+,10+/m0/s1 |
| InChIKey | KKGAEERCEJJJSE-SGIHWFKDSA-N |
| XLogP | 0.83 |
| TPSA | 61.55 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 213.28 |
| LogP ≤ 5 | 0.83 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |