methyl 2-[(1R,2R)-7-oxabicyclo[2.2.1]heptan-2-yl]acetate

C9H14O3 — CID 130359597

IUPACmethyl 2-[(1R,2R)-7-oxabicyclo[2.2.1]heptan-2-yl]acetate
SMILESCOC(=O)C[C@H]1CC2CC[C@H]1O2
InChIInChI=1S/C9H14O3/c1-11-9(10)5-6-4-7-2-3-8(6)12-7/h6-8H,2-5H2,1H3/t6-,7?,8-/m1/s1
InChIKeyGWHOAVXZRIQZCG-OECOWPMFSA-N
MW170.21 g/mol
LogP1.12
Rot. Bonds2

About methyl 2-[(1R,2R)-7-oxabicyclo[2.2.1]heptan-2-yl]acetate

methyl 2-[(1R,2R)-7-oxabicyclo[2.2.1]heptan-2-yl]acetate (PubChem CID 130359597) has the molecular formula C9H14O3 and a molecular weight of 170.21 g/mol. Its IUPAC name is methyl 2-[(1R,2R)-7-oxabicyclo[2.2.1]heptan-2-yl]acetate.

Molecular Properties

Compound Namemethyl 2-[(1R,2R)-7-oxabicyclo[2.2.1]heptan-2-yl]acetate
PubChem CID130359597
Molecular FormulaC9H14O3
Molecular Weight170.21 g/mol
Exact Mass170.09
IUPAC Namemethyl 2-[(1R,2R)-7-oxabicyclo[2.2.1]heptan-2-yl]acetate
SMILESCOC(=O)C[C@H]1CC2CC[C@H]1O2
InChIInChI=1S/C9H14O3/c1-11-9(10)5-6-4-7-2-3-8(6)12-7/h6-8H,2-5H2,1H3/t6-,7?,8-/m1/s1
InChIKeyGWHOAVXZRIQZCG-OECOWPMFSA-N
XLogP1.12
TPSA35.53 Ų
H-Bond Donors
H-Bond Acceptors3
Rotatable Bonds2
Heavy Atoms12
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500170.21
LogP ≤ 51.12
H-Bond Donors ≤ 50
H-Bond Acceptors ≤ 103

Analyze methyl 2-[(1R,2R)-7-oxabicyclo[2.2.1]heptan-2-yl]acetate with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of methyl 2-[(1R,2R)-7-oxabicyclo[2.2.1]heptan-2-yl]acetate?
The IUPAC name of methyl 2-[(1R,2R)-7-oxabicyclo[2.2.1]heptan-2-yl]acetate (CID 130359597) is methyl 2-[(1R,2R)-7-oxabicyclo[2.2.1]heptan-2-yl]acetate.
What is the SMILES notation for methyl 2-[(1R,2R)-7-oxabicyclo[2.2.1]heptan-2-yl]acetate?
The canonical SMILES for methyl 2-[(1R,2R)-7-oxabicyclo[2.2.1]heptan-2-yl]acetate is COC(=O)C[C@H]1CC2CC[C@H]1O2.
What is the InChIKey of methyl 2-[(1R,2R)-7-oxabicyclo[2.2.1]heptan-2-yl]acetate?
The InChIKey is GWHOAVXZRIQZCG-OECOWPMFSA-N. The full InChI is InChI=1S/C9H14O3/c1-11-9(10)5-6-4-7-2-3-8(6)12-7/h6-8H,2-5H2,1H3/t6-,7?,8-/m1/s1.
What are the key properties of methyl 2-[(1R,2R)-7-oxabicyclo[2.2.1]heptan-2-yl]acetate?
methyl 2-[(1R,2R)-7-oxabicyclo[2.2.1]heptan-2-yl]acetate has a molecular weight of 170.21 g/mol, XLogP of 1.12, 2 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for methyl 2-[(1R,2R)-7-oxabicyclo[2.2.1]heptan-2-yl]acetate is sourced from PubChem (CID 130359597), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).