About methyl 2-[(1R,2R)-7-oxabicyclo[2.2.1]heptan-2-yl]acetate
methyl 2-[(1R,2R)-7-oxabicyclo[2.2.1]heptan-2-yl]acetate (PubChem CID 130359597) has the molecular formula C9H14O3
and a molecular weight of 170.21 g/mol. Its IUPAC name is methyl 2-[(1R,2R)-7-oxabicyclo[2.2.1]heptan-2-yl]acetate.
Analyze methyl 2-[(1R,2R)-7-oxabicyclo[2.2.1]heptan-2-yl]acetate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of methyl 2-[(1R,2R)-7-oxabicyclo[2.2.1]heptan-2-yl]acetate?
The IUPAC name of methyl 2-[(1R,2R)-7-oxabicyclo[2.2.1]heptan-2-yl]acetate (CID 130359597) is methyl 2-[(1R,2R)-7-oxabicyclo[2.2.1]heptan-2-yl]acetate.
What is the SMILES notation for methyl 2-[(1R,2R)-7-oxabicyclo[2.2.1]heptan-2-yl]acetate?
The canonical SMILES for methyl 2-[(1R,2R)-7-oxabicyclo[2.2.1]heptan-2-yl]acetate is COC(=O)C[C@H]1CC2CC[C@H]1O2.
What is the InChIKey of methyl 2-[(1R,2R)-7-oxabicyclo[2.2.1]heptan-2-yl]acetate?
The InChIKey is GWHOAVXZRIQZCG-OECOWPMFSA-N. The full InChI is InChI=1S/C9H14O3/c1-11-9(10)5-6-4-7-2-3-8(6)12-7/h6-8H,2-5H2,1H3/t6-,7?,8-/m1/s1.
What are the key properties of methyl 2-[(1R,2R)-7-oxabicyclo[2.2.1]heptan-2-yl]acetate?
methyl 2-[(1R,2R)-7-oxabicyclo[2.2.1]heptan-2-yl]acetate has a molecular weight of 170.21 g/mol, XLogP of 1.12, 2 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for methyl 2-[(1R,2R)-7-oxabicyclo[2.2.1]heptan-2-yl]acetate is sourced from PubChem (CID 130359597), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).