C12H22N2O3 — CID 114267337
2-amino-4-methoxy-N-(7-oxabicyclo[2.2.1]heptan-2-ylmethyl)butanamide (PubChem CID 114267337) has the molecular formula C12H22N2O3 and a molecular weight of 242.32 g/mol. Its IUPAC name is 2-amino-4-methoxy-N-(7-oxabicyclo[2.2.1]heptan-2-ylmethyl)butanamide.
| Compound Name | 2-amino-4-methoxy-N-(7-oxabicyclo[2.2.1]heptan-2-ylmethyl)butanamide |
|---|---|
| PubChem CID | 114267337 |
| Molecular Formula | C12H22N2O3 |
| Molecular Weight | 242.32 g/mol |
| Exact Mass | 242.16 |
| IUPAC Name | 2-amino-4-methoxy-N-(7-oxabicyclo[2.2.1]heptan-2-ylmethyl)butanamide |
| SMILES | COCCC(N)C(=O)NCC1CC2CCC1O2 |
| InChI | InChI=1S/C12H22N2O3/c1-16-5-4-10(13)12(15)14-7-8-6-9-2-3-11(8)17-9/h8-11H,2-7,13H2,1H3,(H,14,15) |
| InChIKey | HUHWXRRVNJNBFQ-UHFFFAOYSA-N |
| XLogP | 0.03 |
| TPSA | 73.58 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 242.32 |
| LogP ≤ 5 | 0.03 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |