C7H17N3O2 — CID 62477473
2-amino-N-(2-aminoethyl)-4-methoxybutanamide (PubChem CID 62477473) has the molecular formula C7H17N3O2 and a molecular weight of 175.23 g/mol. Its IUPAC name is 2-amino-N-(2-aminoethyl)-4-methoxybutanamide.
| Compound Name | 2-amino-N-(2-aminoethyl)-4-methoxybutanamide |
|---|---|
| PubChem CID | 62477473 |
| Molecular Formula | C7H17N3O2 |
| Molecular Weight | 175.23 g/mol |
| Exact Mass | 175.13 |
| IUPAC Name | 2-amino-N-(2-aminoethyl)-4-methoxybutanamide |
| SMILES | COCCC(N)C(=O)NCCN |
| InChI | InChI=1S/C7H17N3O2/c1-12-5-2-6(9)7(11)10-4-3-8/h6H,2-5,8-9H2,1H3,(H,10,11) |
| InChIKey | ZGDMLQZAKBJIBC-UHFFFAOYSA-N |
| XLogP | -1.57 |
| TPSA | 90.37 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 175.23 |
| LogP ≤ 5 | -1.57 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |