C9H21N3O4S — CID 106337528
2-amino-N-[2-(dimethylsulfamoyl)ethyl]-4-methoxybutanamide (PubChem CID 106337528) has the molecular formula C9H21N3O4S and a molecular weight of 267.35 g/mol. Its IUPAC name is 2-amino-N-[2-(dimethylsulfamoyl)ethyl]-4-methoxybutanamide.
| Compound Name | 2-amino-N-[2-(dimethylsulfamoyl)ethyl]-4-methoxybutanamide |
|---|---|
| PubChem CID | 106337528 |
| Molecular Formula | C9H21N3O4S |
| Molecular Weight | 267.35 g/mol |
| Exact Mass | 267.13 |
| IUPAC Name | 2-amino-N-[2-(dimethylsulfamoyl)ethyl]-4-methoxybutanamide |
| SMILES | COCCC(N)C(=O)NCCS(=O)(=O)N(C)C |
| InChI | InChI=1S/C9H21N3O4S/c1-12(2)17(14,15)7-5-11-9(13)8(10)4-6-16-3/h8H,4-7,10H2,1-3H3,(H,11,13) |
| InChIKey | RFQJRSMUVUXPLC-UHFFFAOYSA-N |
| XLogP | -1.64 |
| TPSA | 101.73 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 267.35 |
| LogP ≤ 5 | -1.64 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |