C8H19N3O2 — CID 62477474
2-amino-N-(3-aminopropyl)-4-methoxybutanamide (PubChem CID 62477474) has the molecular formula C8H19N3O2 and a molecular weight of 189.26 g/mol. Its IUPAC name is 2-amino-N-(3-aminopropyl)-4-methoxybutanamide.
| Compound Name | 2-amino-N-(3-aminopropyl)-4-methoxybutanamide |
|---|---|
| PubChem CID | 62477474 |
| Molecular Formula | C8H19N3O2 |
| Molecular Weight | 189.26 g/mol |
| Exact Mass | 189.15 |
| IUPAC Name | 2-amino-N-(3-aminopropyl)-4-methoxybutanamide |
| SMILES | COCCC(N)C(=O)NCCCN |
| InChI | InChI=1S/C8H19N3O2/c1-13-6-3-7(10)8(12)11-5-2-4-9/h7H,2-6,9-10H2,1H3,(H,11,12) |
| InChIKey | LQUZFXWZWHZJKM-UHFFFAOYSA-N |
| XLogP | -1.18 |
| TPSA | 90.37 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 189.26 |
| LogP ≤ 5 | -1.18 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|