C7H17N3O3S — CID 106337421
(2S)-2-amino-N-[2-(dimethylsulfamoyl)ethyl]propanamide (PubChem CID 106337421) has the molecular formula C7H17N3O3S and a molecular weight of 223.30 g/mol. Its IUPAC name is (2S)-2-amino-N-[2-(dimethylsulfamoyl)ethyl]propanamide.
| Compound Name | (2S)-2-amino-N-[2-(dimethylsulfamoyl)ethyl]propanamide |
|---|---|
| PubChem CID | 106337421 |
| Molecular Formula | C7H17N3O3S |
| Molecular Weight | 223.30 g/mol |
| Exact Mass | 223.10 |
| IUPAC Name | (2S)-2-amino-N-[2-(dimethylsulfamoyl)ethyl]propanamide |
| SMILES | C[C@H](N)C(=O)NCCS(=O)(=O)N(C)C |
| InChI | InChI=1S/C7H17N3O3S/c1-6(8)7(11)9-4-5-14(12,13)10(2)3/h6H,4-5,8H2,1-3H3,(H,9,11)/t6-/m0/s1 |
| InChIKey | BHNBDTZZUOGBST-LURJTMIESA-N |
| XLogP | -1.66 |
| TPSA | 92.50 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 223.30 |
| LogP ≤ 5 | -1.66 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |