C10H16ClNO2 — CID 130164935
2-chloro-N-(7-oxabicyclo[2.2.1]heptan-2-ylmethyl)propanamide (PubChem CID 130164935) has the molecular formula C10H16ClNO2 and a molecular weight of 217.70 g/mol. Its IUPAC name is 2-chloro-N-(7-oxabicyclo[2.2.1]heptan-2-ylmethyl)propanamide.
| Compound Name | 2-chloro-N-(7-oxabicyclo[2.2.1]heptan-2-ylmethyl)propanamide |
|---|---|
| PubChem CID | 130164935 |
| Molecular Formula | C10H16ClNO2 |
| Molecular Weight | 217.70 g/mol |
| Exact Mass | 217.09 |
| IUPAC Name | 2-chloro-N-(7-oxabicyclo[2.2.1]heptan-2-ylmethyl)propanamide |
| SMILES | CC(Cl)C(=O)NCC1CC2CCC1O2 |
| InChI | InChI=1S/C10H16ClNO2/c1-6(11)10(13)12-5-7-4-8-2-3-9(7)14-8/h6-9H,2-5H2,1H3,(H,12,13) |
| InChIKey | MAORKLITEQKUEB-UHFFFAOYSA-N |
| XLogP | 1.30 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 217.70 |
| LogP ≤ 5 | 1.30 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|