C10H20O14S4 — CID 98506478
[(1S,2S,3R,4R,5R,6S)-2,3-dihydroxy-4,5,6-tris(methylsulfonyloxy)cyclohexyl] methanesulfonate (PubChem CID 98506478) has the molecular formula C10H20O14S4 and a molecular weight of 492.52 g/mol. Its IUPAC name is [(1S,2S,3R,4R,5R,6S)-2,3-dihydroxy-4,5,6-tris(methylsulfonyloxy)cyclohexyl] methanesulfonate.
| Compound Name | [(1S,2S,3R,4R,5R,6S)-2,3-dihydroxy-4,5,6-tris(methylsulfonyloxy)cyclohexyl] methanesulfonate |
|---|---|
| PubChem CID | 98506478 |
| Molecular Formula | C10H20O14S4 |
| Molecular Weight | 492.52 g/mol |
| Exact Mass | 491.97 |
| IUPAC Name | [(1S,2S,3R,4R,5R,6S)-2,3-dihydroxy-4,5,6-tris(methylsulfonyloxy)cyclohexyl] methanesulfonate |
| SMILES | CS(=O)(=O)O[C@@H]1[C@H](OS(C)(=O)=O)[C@H](OS(C)(=O)=O)[C@H](O)[C@H](O)[C@@H]1OS(C)(=O)=O |
| InChI | InChI=1S/C10H20O14S4/c1-25(13,14)21-7-5(11)6(12)8(22-26(2,15)16)10(24-28(4,19)20)9(7)23-27(3,17)18/h5-12H,1-4H3/t5-,6+,7-,8+,9-,10+ |
| InChIKey | IRDGXWZDMGYTGA-VNQPEFDQSA-N |
| XLogP | -3.90 |
| TPSA | 213.94 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 14 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 492.52 |
| LogP ≤ 5 | -3.90 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 14 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|